C19H14F2N2O3 — CID 31725805
5-(4-fluorophenyl)-N'-[2-(4-fluorophenyl)acetyl]furan-2-carbohydrazide (PubChem CID 31725805) has the molecular formula C19H14F2N2O3 and a molecular weight of 356.33 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N'-[2-(4-fluorophenyl)acetyl]furan-2-carbohydrazide.
| Compound Name | 5-(4-fluorophenyl)-N'-[2-(4-fluorophenyl)acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 31725805 |
| Molecular Formula | C19H14F2N2O3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 5-(4-fluorophenyl)-N'-[2-(4-fluorophenyl)acetyl]furan-2-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C19H14F2N2O3/c20-14-5-1-12(2-6-14)11-18(24)22-23-19(25)17-10-9-16(26-17)13-3-7-15(21)8-4-13/h1-10H,11H2,(H,22,24)(H,23,25) |
| InChIKey | BRGRAMXWKHBYEA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|