C22H18FN5O3S — CID 24502732
5-(4-fluorophenyl)-N'-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]furan-2-carbohydrazide (PubChem CID 24502732) has the molecular formula C22H18FN5O3S and a molecular weight of 451.48 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N'-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]furan-2-carbohydrazide.
| Compound Name | 5-(4-fluorophenyl)-N'-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 24502732 |
| Molecular Formula | C22H18FN5O3S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 5-(4-fluorophenyl)-N'-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]furan-2-carbohydrazide |
| SMILES | Cn1cnnc1SCc1ccc(C(=O)NNC(=O)c2ccc(-c3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C22H18FN5O3S/c1-28-13-24-27-22(28)32-12-14-2-4-16(5-3-14)20(29)25-26-21(30)19-11-10-18(31-19)15-6-8-17(23)9-7-15/h2-11,13H,12H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | CWULMHLFMSAHOW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|