C20H21FN6O4S2 — CID 24636444
4-fluoro-N-[3-[2-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide (PubChem CID 24636444) has the molecular formula C20H21FN6O4S2 and a molecular weight of 492.56 g/mol. Its IUPAC name is 4-fluoro-N-[3-[2-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-[2-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24636444 |
| Molecular Formula | C20H21FN6O4S2 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-fluoro-N-[3-[2-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide |
| SMILES | Cn1cnnc1SCc1ccc(C(=O)NNC(=O)CCNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H21FN6O4S2/c1-27-13-22-26-20(27)32-12-14-2-4-15(5-3-14)19(29)25-24-18(28)10-11-23-33(30,31)17-8-6-16(21)7-9-17/h2-9,13,23H,10-12H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | GXGGDYSGHYIQQC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|