C19H18FN5OS — CID 7987781
N-[(Z)-1-(2-fluorophenyl)ethylideneamino]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide (PubChem CID 7987781) has the molecular formula C19H18FN5OS and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[(Z)-1-(2-fluorophenyl)ethylideneamino]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide.
| Compound Name | N-[(Z)-1-(2-fluorophenyl)ethylideneamino]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 7987781 |
| Molecular Formula | C19H18FN5OS |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[(Z)-1-(2-fluorophenyl)ethylideneamino]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(CSc2nncn2C)cc1)c1ccccc1F |
| InChI | InChI=1S/C19H18FN5OS/c1-13(16-5-3-4-6-17(16)20)22-23-18(26)15-9-7-14(8-10-15)11-27-19-24-21-12-25(19)2/h3-10,12H,11H2,1-2H3,(H,23,26)/b22-13- |
| InChIKey | DKOANXVAJROWIV-XKZIYDEJSA-N |
| XLogP | 3.40 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|