C20H24FN3O4S — CID 9340595
4-tert-butyl-N-[3-[2-(4-fluorobenzoyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide (PubChem CID 9340595) has the molecular formula C20H24FN3O4S and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[2-(4-fluorobenzoyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-[2-(4-fluorobenzoyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9340595 |
| Molecular Formula | C20H24FN3O4S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-tert-butyl-N-[3-[2-(4-fluorobenzoyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)NNC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H24FN3O4S/c1-20(2,3)15-6-10-17(11-7-15)29(27,28)22-13-12-18(25)23-24-19(26)14-4-8-16(21)9-5-14/h4-11,22H,12-13H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | ZHBSUUBFOCVELV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|