C20H25FN2O3S — CID 24536886
3-[(4-tert-butylphenyl)sulfonylamino]-N-[(2-fluorophenyl)methyl]propanamide (PubChem CID 24536886) has the molecular formula C20H25FN2O3S and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)sulfonylamino]-N-[(2-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-[(2-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 24536886 |
| Molecular Formula | C20H25FN2O3S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-[(2-fluorophenyl)methyl]propanamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C20H25FN2O3S/c1-20(2,3)16-8-10-17(11-9-16)27(25,26)23-13-12-19(24)22-14-15-6-4-5-7-18(15)21/h4-11,23H,12-14H2,1-3H3,(H,22,24) |
| InChIKey | MCSXHURFTVGPOI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |