C21H26N2O5S — CID 9413514
methyl 4-[3-[(4-tert-butylphenyl)sulfonylamino]propanoylamino]benzoate (PubChem CID 9413514) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is methyl 4-[3-[(4-tert-butylphenyl)sulfonylamino]propanoylamino]benzoate.
| Compound Name | methyl 4-[3-[(4-tert-butylphenyl)sulfonylamino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 9413514 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl 4-[3-[(4-tert-butylphenyl)sulfonylamino]propanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CCNS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-21(2,3)16-7-11-18(12-8-16)29(26,27)22-14-13-19(24)23-17-9-5-15(6-10-17)20(25)28-4/h5-12,22H,13-14H2,1-4H3,(H,23,24) |
| InChIKey | NSRLZUJYJNIDRU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |