C15H21NO6S — CID 21348248
methyl 4-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]sulfamoyl]benzoate (PubChem CID 21348248) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is methyl 4-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 21348248 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | methyl 4-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H21NO6S/c1-15(2,3)22-13(17)9-10-16-23(19,20)12-7-5-11(6-8-12)14(18)21-4/h5-8,16H,9-10H2,1-4H3 |
| InChIKey | XRQUYJQPTSDVIV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |