C12H17NO5S — CID 65113818
methyl 4-[(2-hydroxy-2-methylpropyl)sulfamoyl]benzoate (PubChem CID 65113818) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 4-[(2-hydroxy-2-methylpropyl)sulfamoyl]benzoate.
| Compound Name | methyl 4-[(2-hydroxy-2-methylpropyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 65113818 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 4-[(2-hydroxy-2-methylpropyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC(C)(C)O)cc1 |
| InChI | InChI=1S/C12H17NO5S/c1-12(2,15)8-13-19(16,17)10-6-4-9(5-7-10)11(14)18-3/h4-7,13,15H,8H2,1-3H3 |
| InChIKey | DBIATESQLWNGOB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |