C12H17NO6S — CID 66170749
methyl 3-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]benzoate (PubChem CID 66170749) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl 3-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]benzoate.
| Compound Name | methyl 3-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 66170749 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl 3-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NCC(C)(O)CO)c1 |
| InChI | InChI=1S/C12H17NO6S/c1-12(16,8-14)7-13-20(17,18)10-5-3-4-9(6-10)11(15)19-2/h3-6,13-14,16H,7-8H2,1-2H3 |
| InChIKey | CHRBEINWFIBAQO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |