C10H14N2O5S — CID 65113024
N-(2-hydroxy-2-methylpropyl)-4-nitrobenzenesulfonamide (PubChem CID 65113024) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(2-hydroxy-2-methylpropyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 65113024 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-4-nitrobenzenesulfonamide |
| SMILES | CC(C)(O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H14N2O5S/c1-10(2,13)7-11-18(16,17)9-5-3-8(4-6-9)12(14)15/h3-6,11,13H,7H2,1-2H3 |
| InChIKey | JCQSQRBRWHWYHS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|