C13H19N3O5S — CID 17192795
N-tert-butyl-3-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 17192795) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-tert-butyl-3-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-tert-butyl-3-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17192795 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N-tert-butyl-3-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H19N3O5S/c1-13(2,3)15-12(17)8-9-14-22(20,21)11-6-4-10(5-7-11)16(18)19/h4-7,14H,8-9H2,1-3H3,(H,15,17) |
| InChIKey | PCFADFYSYOFYTE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|