C11H17ClN4O5S — CID 119305416
3-amino-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]propanamide;hydrochloride (PubChem CID 119305416) has the molecular formula C11H17ClN4O5S and a molecular weight of 352.80 g/mol. Its IUPAC name is 3-amino-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119305416 |
| Molecular Formula | C11H17ClN4O5S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-amino-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]propanamide;hydrochloride |
| SMILES | Cl.NCCC(=O)NCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H16N4O5S.ClH/c12-6-5-11(16)13-7-8-14-21(19,20)10-3-1-9(2-4-10)15(17)18;/h1-4,14H,5-8,12H2,(H,13,16);1H |
| InChIKey | LEQKHTGVRIZUSX-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|