C13H21ClN4O6S — CID 119752398
2-(2-methoxyethylamino)-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]acetamide;hydrochloride (PubChem CID 119752398) has the molecular formula C13H21ClN4O6S and a molecular weight of 396.85 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119752398 |
| Molecular Formula | C13H21ClN4O6S |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C13H20N4O6S.ClH/c1-23-9-8-14-10-13(18)15-6-7-16-24(21,22)12-4-2-11(3-5-12)17(19)20;/h2-5,14,16H,6-10H2,1H3,(H,15,18);1H |
| InChIKey | GEFOUNKVGMFQLQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|