C13H21ClN4O5S — CID 119752364
4-(methylamino)-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]butanamide;hydrochloride (PubChem CID 119752364) has the molecular formula C13H21ClN4O5S and a molecular weight of 380.85 g/mol. Its IUPAC name is 4-(methylamino)-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119752364 |
| Molecular Formula | C13H21ClN4O5S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-(methylamino)-N-[2-[(4-nitrophenyl)sulfonylamino]ethyl]butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C13H20N4O5S.ClH/c1-14-8-2-3-13(18)15-9-10-16-23(21,22)12-6-4-11(5-7-12)17(19)20;/h4-7,14,16H,2-3,8-10H2,1H3,(H,15,18);1H |
| InChIKey | GRXHUCYLWYZCMH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|