C16H21N5O5S2 — CID 17192985
N-[5-(2,2-dimethylpropyl)-1,3,4-thiadiazol-2-yl]-3-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 17192985) has the molecular formula C16H21N5O5S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[5-(2,2-dimethylpropyl)-1,3,4-thiadiazol-2-yl]-3-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-[5-(2,2-dimethylpropyl)-1,3,4-thiadiazol-2-yl]-3-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17192985 |
| Molecular Formula | C16H21N5O5S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[5-(2,2-dimethylpropyl)-1,3,4-thiadiazol-2-yl]-3-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | CC(C)(C)Cc1nnc(NC(=O)CCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C16H21N5O5S2/c1-16(2,3)10-14-19-20-15(27-14)18-13(22)8-9-17-28(25,26)12-6-4-11(5-7-12)21(23)24/h4-7,17H,8-10H2,1-3H3,(H,18,20,22) |
| InChIKey | CKFHXBJYJPJELB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|