C13H14N4O5S2 — CID 17154103
3-[(4-methylphenyl)sulfonylamino]-N-(5-nitro-1,3-thiazol-2-yl)propanamide (PubChem CID 17154103) has the molecular formula C13H14N4O5S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]-N-(5-nitro-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]-N-(5-nitro-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 17154103 |
| Molecular Formula | C13H14N4O5S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]-N-(5-nitro-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)Nc2ncc([N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C13H14N4O5S2/c1-9-2-4-10(5-3-9)24(21,22)15-7-6-11(18)16-13-14-8-12(23-13)17(19)20/h2-5,8,15H,6-7H2,1H3,(H,14,16,18) |
| InChIKey | GGQJAIKXVBYJLP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|