C20H18N4O7S2 — CID 25036705
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-methyl-3-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 25036705) has the molecular formula C20H18N4O7S2 and a molecular weight of 490.52 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-methyl-3-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-methyl-3-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25036705 |
| Molecular Formula | C20H18N4O7S2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-methyl-3-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C(=O)OCC(=O)Nc3ncc([N+](=O)[O-])s3)ccc2C)cc1 |
| InChI | InChI=1S/C20H18N4O7S2/c1-12-3-7-15(8-4-12)23-33(29,30)16-9-14(6-5-13(16)2)19(26)31-11-17(25)22-20-21-10-18(32-20)24(27)28/h3-10,23H,11H2,1-2H3,(H,21,22,25) |
| InChIKey | YSYPOTLEORIAPE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 157.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|