C19H11N3O8S2 — CID 23852805
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 23852805) has the molecular formula C19H11N3O8S2 and a molecular weight of 473.44 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 23852805 |
| Molecular Formula | C19H11N3O8S2 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C19H11N3O8S2/c23-15(21-19-20-8-16(31-19)22(26)27)9-30-18(25)10-5-6-12-14(7-10)32(28,29)13-4-2-1-3-11(13)17(12)24/h1-8H,9H2,(H,20,21,23) |
| InChIKey | DUWSAIWREJMJPY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 162.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|