C23H17NO6S — CID 4854474
[2-(4-methylanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 4854474) has the molecular formula C23H17NO6S and a molecular weight of 435.46 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 4854474 |
| Molecular Formula | C23H17NO6S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H17NO6S/c1-14-6-9-16(10-7-14)24-21(25)13-30-23(27)15-8-11-18-20(12-15)31(28,29)19-5-3-2-4-17(19)22(18)26/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | IHTYMGABGWYEHG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |