C24H19NO6S — CID 3452572
[2-oxo-2-(1-phenylethylamino)ethyl] 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 3452572) has the molecular formula C24H19NO6S and a molecular weight of 449.48 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 3452572 |
| Molecular Formula | C24H19NO6S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | CC(NC(=O)COC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C24H19NO6S/c1-15(16-7-3-2-4-8-16)25-22(26)14-31-24(28)17-11-12-19-21(13-17)32(29,30)20-10-6-5-9-18(20)23(19)27/h2-13,15H,14H2,1H3,(H,25,26) |
| InChIKey | QYGZOUYOZHGSIJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |