C22H14FNO6S — CID 4855820
[2-(3-fluoroanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 4855820) has the molecular formula C22H14FNO6S and a molecular weight of 439.42 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 4855820 |
| Molecular Formula | C22H14FNO6S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H14FNO6S/c23-14-4-3-5-15(11-14)24-20(25)12-30-22(27)13-8-9-17-19(10-13)31(28,29)18-7-2-1-6-16(18)21(17)26/h1-11H,12H2,(H,24,25) |
| InChIKey | MSKSWMOVJJIIAW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |