C17H12O7S — CID 16568626
(2-methoxy-2-oxoethyl) 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 16568626) has the molecular formula C17H12O7S and a molecular weight of 360.34 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | (2-methoxy-2-oxoethyl) 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 16568626 |
| Molecular Formula | C17H12O7S |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | COC(=O)COC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H12O7S/c1-23-15(18)9-24-17(20)10-6-7-12-14(8-10)25(21,22)13-5-3-2-4-11(13)16(12)19/h2-8H,9H2,1H3 |
| InChIKey | AOOXEJDWUBLSOF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |