C18H17ClNO5S- — CID 53351147
2-(dimethylamino)ethyl 9,10,10-trioxothioxanthene-3-carboxylate chloride (PubChem CID 53351147) has the molecular formula C18H17ClNO5S- and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 9,10,10-trioxothioxanthene-3-carboxylate chloride.
| Compound Name | 2-(dimethylamino)ethyl 9,10,10-trioxothioxanthene-3-carboxylate chloride |
|---|---|
| PubChem CID | 53351147 |
| Molecular Formula | C18H17ClNO5S- |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-(dimethylamino)ethyl 9,10,10-trioxothioxanthene-3-carboxylate chloride |
| SMILES | CN(C)CCOC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O.[Cl-] |
| InChI | InChI=1S/C18H17NO5S.ClH/c1-19(2)9-10-24-18(21)12-7-8-14-16(11-12)25(22,23)15-6-4-3-5-13(15)17(14)20;/h3-8,11H,9-10H2,1-2H3;1H/p-1 |
| InChIKey | OGGYXVACCXEFOE-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |