C22H16O5S — CID 2447972
(3-ethylphenyl) 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 2447972) has the molecular formula C22H16O5S and a molecular weight of 392.43 g/mol. Its IUPAC name is (3-ethylphenyl) 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | (3-ethylphenyl) 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 2447972 |
| Molecular Formula | C22H16O5S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (3-ethylphenyl) 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | CCc1cccc(OC(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C22H16O5S/c1-2-14-6-5-7-16(12-14)27-22(24)15-10-11-18-20(13-15)28(25,26)19-9-4-3-8-17(19)21(18)23/h3-13H,2H2,1H3 |
| InChIKey | UCFQXQSZDZPPLC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|