C26H23NO6S — CID 2419825
[2-(4-butylanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 2419825) has the molecular formula C26H23NO6S and a molecular weight of 477.54 g/mol. Its IUPAC name is [2-(4-butylanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | [2-(4-butylanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 2419825 |
| Molecular Formula | C26H23NO6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [2-(4-butylanilino)-2-oxoethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | CCCCc1ccc(NC(=O)COC(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H23NO6S/c1-2-3-6-17-9-12-19(13-10-17)27-24(28)16-33-26(30)18-11-14-21-23(15-18)34(31,32)22-8-5-4-7-20(22)25(21)29/h4-5,7-15H,2-3,6,16H2,1H3,(H,27,28) |
| InChIKey | XMJZWTUSEPGELL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |