C19H16O5S — CID 17469972
cyclopentyl 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 17469972) has the molecular formula C19H16O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is cyclopentyl 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | cyclopentyl 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 17469972 |
| Molecular Formula | C19H16O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | cyclopentyl 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | O=C(OC1CCCC1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H16O5S/c20-18-14-7-3-4-8-16(14)25(22,23)17-11-12(9-10-15(17)18)19(21)24-13-5-1-2-6-13/h3-4,7-11,13H,1-2,5-6H2 |
| InChIKey | SFQFATHSCZRWDH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |