C20H17NO6S — CID 119166682
1-(9,10,10-trioxothioxanthene-3-carbonyl)piperidine-4-carboxylic acid (PubChem CID 119166682) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is 1-(9,10,10-trioxothioxanthene-3-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(9,10,10-trioxothioxanthene-3-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119166682 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1-(9,10,10-trioxothioxanthene-3-carbonyl)piperidine-4-carboxylic acid |
| SMILES | O=C1c2ccccc2S(=O)(=O)c2cc(C(=O)N3CCC(C(=O)O)CC3)ccc21 |
| InChI | InChI=1S/C20H17NO6S/c22-18-14-3-1-2-4-16(14)28(26,27)17-11-13(5-6-15(17)18)19(23)21-9-7-12(8-10-21)20(24)25/h1-6,11-12H,7-10H2,(H,24,25) |
| InChIKey | VTKCLMXQUQMVEX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |