C26H21NO3 — CID 633858
2-(4-phenylpiperidine-1-carbonyl)anthracene-9,10-dione (PubChem CID 633858) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-(4-phenylpiperidine-1-carbonyl)anthracene-9,10-dione.
| Compound Name | 2-(4-phenylpiperidine-1-carbonyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 633858 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(4-phenylpiperidine-1-carbonyl)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(C(=O)N3CCC(c4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C26H21NO3/c28-24-20-8-4-5-9-21(20)25(29)23-16-19(10-11-22(23)24)26(30)27-14-12-18(13-15-27)17-6-2-1-3-7-17/h1-11,16,18H,12-15H2 |
| InChIKey | NSHYLQCKBJJESY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|