C19H17NO3 — CID 110883962
2-(4-hydroxypiperidine-1-carbonyl)fluoren-9-one (PubChem CID 110883962) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-(4-hydroxypiperidine-1-carbonyl)fluoren-9-one.
| Compound Name | 2-(4-hydroxypiperidine-1-carbonyl)fluoren-9-one |
|---|---|
| PubChem CID | 110883962 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(4-hydroxypiperidine-1-carbonyl)fluoren-9-one |
| SMILES | O=C1c2ccccc2-c2ccc(C(=O)N3CCC(O)CC3)cc21 |
| InChI | InChI=1S/C19H17NO3/c21-13-7-9-20(10-8-13)19(23)12-5-6-15-14-3-1-2-4-16(14)18(22)17(15)11-12/h1-6,11,13,21H,7-10H2 |
| InChIKey | DZSBCCBAGJDTSB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |