C25H18Cl2N2O3 — CID 55800240
2-[4-(2,3-dichlorobenzoyl)piperazine-1-carbonyl]fluoren-9-one (PubChem CID 55800240) has the molecular formula C25H18Cl2N2O3 and a molecular weight of 465.34 g/mol. Its IUPAC name is 2-[4-(2,3-dichlorobenzoyl)piperazine-1-carbonyl]fluoren-9-one.
| Compound Name | 2-[4-(2,3-dichlorobenzoyl)piperazine-1-carbonyl]fluoren-9-one |
|---|---|
| PubChem CID | 55800240 |
| Molecular Formula | C25H18Cl2N2O3 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-[4-(2,3-dichlorobenzoyl)piperazine-1-carbonyl]fluoren-9-one |
| SMILES | O=C1c2ccccc2-c2ccc(C(=O)N3CCN(C(=O)c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C25H18Cl2N2O3/c26-21-7-3-6-19(22(21)27)25(32)29-12-10-28(11-13-29)24(31)15-8-9-17-16-4-1-2-5-18(16)23(30)20(17)14-15/h1-9,14H,10-13H2 |
| InChIKey | DTXKAWOUERDEPH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |