C24H21N3O5 — CID 55950727
1-[2-oxo-2-[4-(9-oxofluorene-2-carbonyl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 55950727) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-[2-oxo-2-[4-(9-oxofluorene-2-carbonyl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-oxo-2-[4-(9-oxofluorene-2-carbonyl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55950727 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 1-[2-oxo-2-[4-(9-oxofluorene-2-carbonyl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1c2ccccc2-c2ccc(C(=O)N3CCN(C(=O)CN4C(=O)CCC4=O)CC3)cc21 |
| InChI | InChI=1S/C24H21N3O5/c28-20-7-8-21(29)27(20)14-22(30)25-9-11-26(12-10-25)24(32)15-5-6-17-16-3-1-2-4-18(16)23(31)19(17)13-15/h1-6,13H,7-12,14H2 |
| InChIKey | ASDTUHHREGFRPY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|