C19H21F2N3O6 — CID 55826399
1-[2-[4-[4-(difluoromethoxy)-3-methoxybenzoyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 55826399) has the molecular formula C19H21F2N3O6 and a molecular weight of 425.39 g/mol. Its IUPAC name is 1-[2-[4-[4-(difluoromethoxy)-3-methoxybenzoyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-[4-(difluoromethoxy)-3-methoxybenzoyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55826399 |
| Molecular Formula | C19H21F2N3O6 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-[2-[4-[4-(difluoromethoxy)-3-methoxybenzoyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)CN3C(=O)CCC3=O)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C19H21F2N3O6/c1-29-14-10-12(2-3-13(14)30-19(20)21)18(28)23-8-6-22(7-9-23)17(27)11-24-15(25)4-5-16(24)26/h2-3,10,19H,4-9,11H2,1H3 |
| InChIKey | YJKZYGDDWSEPBG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|