C18H18F2N2O5 — CID 17461515
[4-(difluoromethoxy)-3-methoxyphenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 17461515) has the molecular formula C18H18F2N2O5 and a molecular weight of 380.35 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-methoxyphenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(difluoromethoxy)-3-methoxyphenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17461515 |
| Molecular Formula | C18H18F2N2O5 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [4-(difluoromethoxy)-3-methoxyphenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3ccco3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C18H18F2N2O5/c1-25-15-11-12(4-5-13(15)27-18(19)20)16(23)21-6-8-22(9-7-21)17(24)14-3-2-10-26-14/h2-5,10-11,18H,6-9H2,1H3 |
| InChIKey | FQOQINYXYICMGX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |