C20H21F2NO6 — CID 35378219
[4-(difluoromethoxy)-3-methoxyphenyl]methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate (PubChem CID 35378219) has the molecular formula C20H21F2NO6 and a molecular weight of 409.39 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-methoxyphenyl]methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 35378219 |
| Molecular Formula | C20H21F2NO6 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate |
| SMILES | COc1cc(COC(=O)C2CCN(C(=O)c3ccco3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C20H21F2NO6/c1-26-17-11-13(4-5-15(17)29-20(21)22)12-28-19(25)14-6-8-23(9-7-14)18(24)16-3-2-10-27-16/h2-5,10-11,14,20H,6-9,12H2,1H3 |
| InChIKey | AJEGAWZGNXUOKA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |