C25H24F2N2O4 — CID 46649817
N-[3-benzyl-4-(difluoromethoxy)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide (PubChem CID 46649817) has the molecular formula C25H24F2N2O4 and a molecular weight of 454.47 g/mol. Its IUPAC name is N-[3-benzyl-4-(difluoromethoxy)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46649817 |
| Molecular Formula | C25H24F2N2O4 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)c(Cc2ccccc2)c1)C1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C25H24F2N2O4/c26-25(27)33-21-9-8-20(16-19(21)15-17-5-2-1-3-6-17)28-23(30)18-10-12-29(13-11-18)24(31)22-7-4-14-32-22/h1-9,14,16,18,25H,10-13,15H2,(H,28,30) |
| InChIKey | UHTPUPUXUQQSTJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |