C15H21F2N2O3+ — CID 9443217
1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]piperidin-1-ium-4-carboxamide (PubChem CID 9443217) has the molecular formula C15H21F2N2O3+ and a molecular weight of 315.34 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9443217 |
| Molecular Formula | C15H21F2N2O3+ |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]piperidin-1-ium-4-carboxamide |
| SMILES | COc1cc(C[NH+]2CCC(C(N)=O)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C15H20F2N2O3/c1-21-13-8-10(2-3-12(13)22-15(16)17)9-19-6-4-11(5-7-19)14(18)20/h2-3,8,11,15H,4-7,9H2,1H3,(H2,18,20)/p+1 |
| InChIKey | ZUTYYQAYFBGFNX-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |