C16H24NO4+ — CID 7439633
ethyl 1-[(3-hydroxy-4-methoxyphenyl)methyl]piperidin-1-ium-4-carboxylate (PubChem CID 7439633) has the molecular formula C16H24NO4+ and a molecular weight of 294.37 g/mol. Its IUPAC name is ethyl 1-[(3-hydroxy-4-methoxyphenyl)methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(3-hydroxy-4-methoxyphenyl)methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7439633 |
| Molecular Formula | C16H24NO4+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | ethyl 1-[(3-hydroxy-4-methoxyphenyl)methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cc2ccc(OC)c(O)c2)CC1 |
| InChI | InChI=1S/C16H23NO4/c1-3-21-16(19)13-6-8-17(9-7-13)11-12-4-5-15(20-2)14(18)10-12/h4-5,10,13,18H,3,6-9,11H2,1-2H3/p+1 |
| InChIKey | AXDSXXZDMULJGE-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |