C15H23N2O2+ — CID 9442824
1-[(2-methoxy-5-methylphenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 9442824) has the molecular formula C15H23N2O2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-[(2-methoxy-5-methylphenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2-methoxy-5-methylphenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9442824 |
| Molecular Formula | C15H23N2O2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 1-[(2-methoxy-5-methylphenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | COc1ccc(C)cc1C[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-11-3-4-14(19-2)13(9-11)10-17-7-5-12(6-8-17)15(16)18/h3-4,9,12H,5-8,10H2,1-2H3,(H2,16,18)/p+1 |
| InChIKey | IDTAMHBKCJCVSV-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |