C22H33N3O3+2 — CID 9320305
(3aS,7aS)-2-[[4-[(2-methoxy-5-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 9320305) has the molecular formula C22H33N3O3+2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (3aS,7aS)-2-[[4-[(2-methoxy-5-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[[4-[(2-methoxy-5-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 9320305 |
| Molecular Formula | C22H33N3O3+2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (3aS,7aS)-2-[[4-[(2-methoxy-5-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | COc1ccc(C)cc1C[NH+]1CC[NH+](CN2C(=O)[C@H]3CCCC[C@@H]3C2=O)CC1 |
| InChI | InChI=1S/C22H31N3O3/c1-16-7-8-20(28-2)17(13-16)14-23-9-11-24(12-10-23)15-25-21(26)18-5-3-4-6-19(18)22(25)27/h7-8,13,18-19H,3-6,9-12,14-15H2,1-2H3/p+2/t18-,19-/m0/s1 |
| InChIKey | VSGUOAQMXAIURE-OALUTQOASA-P |
| XLogP | -0.58 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|