C19H23NO5 — CID 8862828
(2-methoxy-4-methylphenyl) 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 8862828) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is (2-methoxy-4-methylphenyl) 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | (2-methoxy-4-methylphenyl) 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 8862828 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (2-methoxy-4-methylphenyl) 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | COc1cc(C)ccc1OC(=O)CCN1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C19H23NO5/c1-12-7-8-15(16(11-12)24-2)25-17(21)9-10-20-18(22)13-5-3-4-6-14(13)19(20)23/h7-8,11,13-14H,3-6,9-10H2,1-2H3/t13-,14+ |
| InChIKey | RJYWVADLEILGJJ-OKILXGFUSA-N |
| XLogP | 2.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|