C17H17Cl2NO4 — CID 2672160
(2,5-dichlorophenyl) 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 2672160) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is (2,5-dichlorophenyl) 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | (2,5-dichlorophenyl) 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 2672160 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (2,5-dichlorophenyl) 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H17Cl2NO4/c18-10-5-6-13(19)14(9-10)24-15(21)7-8-20-16(22)11-3-1-2-4-12(11)17(20)23/h5-6,9,11-12H,1-4,7-8H2/t11-,12-/m0/s1 |
| InChIKey | VQGVQLCXYPPHHR-RYUDHWBXSA-N |
| XLogP | 3.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|