C23H29N3O4+2 — CID 9284883
2-[[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]isoindole-1,3-dione (PubChem CID 9284883) has the molecular formula C23H29N3O4+2 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-[[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9284883 |
| Molecular Formula | C23H29N3O4+2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2-[[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]isoindole-1,3-dione |
| SMILES | COc1cc(C)c(C[NH+]2CC[NH+](CN3C(=O)c4ccccc4C3=O)CC2)cc1OC |
| InChI | InChI=1S/C23H27N3O4/c1-16-12-20(29-2)21(30-3)13-17(16)14-24-8-10-25(11-9-24)15-26-22(27)18-6-4-5-7-19(18)23(26)28/h4-7,12-13H,8-11,14-15H2,1-3H3/p+2 |
| InChIKey | PNSDZCFJOMSASI-UHFFFAOYSA-P |
| XLogP | -0.45 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|