C20H23N3O2+2 — CID 6922522
2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]isoindole-1,3-dione (PubChem CID 6922522) has the molecular formula C20H23N3O2+2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6922522 |
| Molecular Formula | C20H23N3O2+2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[NH+]1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H21N3O2/c24-19-17-8-4-5-9-18(17)20(25)23(19)15-22-12-10-21(11-13-22)14-16-6-2-1-3-7-16/h1-9H,10-15H2/p+2 |
| InChIKey | RTNAOYRJFPYUON-UHFFFAOYSA-P |
| XLogP | -0.78 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|