C23H26ClN3O3 — CID 44657834
2-[4-(4-benzylpiperazin-4-ium-1-yl)-4-oxobutyl]isoindole-1,3-dione chloride (PubChem CID 44657834) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperazin-4-ium-1-yl)-4-oxobutyl]isoindole-1,3-dione chloride.
| Compound Name | 2-[4-(4-benzylpiperazin-4-ium-1-yl)-4-oxobutyl]isoindole-1,3-dione chloride |
|---|---|
| PubChem CID | 44657834 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-[4-(4-benzylpiperazin-4-ium-1-yl)-4-oxobutyl]isoindole-1,3-dione chloride |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)N1CC[NH+](Cc2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C23H25N3O3.ClH/c27-21(25-15-13-24(14-16-25)17-18-7-2-1-3-8-18)11-6-12-26-22(28)19-9-4-5-10-20(19)23(26)29;/h1-5,7-10H,6,11-17H2;1H |
| InChIKey | QSDPWNYXHXQVMN-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|