C30H39N3O3 — CID 3365710
2-[11-(4-benzylpiperazin-1-yl)-11-oxoundecyl]isoindole-1,3-dione (PubChem CID 3365710) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-[11-(4-benzylpiperazin-1-yl)-11-oxoundecyl]isoindole-1,3-dione.
| Compound Name | 2-[11-(4-benzylpiperazin-1-yl)-11-oxoundecyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3365710 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 2-[11-(4-benzylpiperazin-1-yl)-11-oxoundecyl]isoindole-1,3-dione |
| SMILES | O=C(CCCCCCCCCCN1C(=O)c2ccccc2C1=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H39N3O3/c34-28(32-22-20-31(21-23-32)24-25-14-8-7-9-15-25)18-10-5-3-1-2-4-6-13-19-33-29(35)26-16-11-12-17-27(26)30(33)36/h7-9,11-12,14-17H,1-6,10,13,18-24H2 |
| InChIKey | VEGQOZITXZLFFH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|