C23H27N3O4 — CID 19572432
2-[6-[4-(furan-2-ylmethyl)piperazin-1-yl]-6-oxohexyl]isoindole-1,3-dione (PubChem CID 19572432) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[6-[4-(furan-2-ylmethyl)piperazin-1-yl]-6-oxohexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[4-(furan-2-ylmethyl)piperazin-1-yl]-6-oxohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19572432 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[6-[4-(furan-2-ylmethyl)piperazin-1-yl]-6-oxohexyl]isoindole-1,3-dione |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C23H27N3O4/c27-21(25-14-12-24(13-15-25)17-18-7-6-16-30-18)10-2-1-5-11-26-22(28)19-8-3-4-9-20(19)23(26)29/h3-4,6-9,16H,1-2,5,10-15,17H2 |
| InChIKey | GMYPIPISJFCJFN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|