C19H20N2O4 — CID 647827
6-(1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)hexanamide (PubChem CID 647827) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)hexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 647827 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)NCc1ccco1 |
| InChI | InChI=1S/C19H20N2O4/c22-17(20-13-14-7-6-12-25-14)10-2-1-5-11-21-18(23)15-8-3-4-9-16(15)19(21)24/h3-4,6-9,12H,1-2,5,10-11,13H2,(H,20,22) |
| InChIKey | VQAUZYZVDDQEIQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|