C24H30N2O4 — CID 8796994
11-(1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)undecanamide (PubChem CID 8796994) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 11-(1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)undecanamide.
| Compound Name | 11-(1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)undecanamide |
|---|---|
| PubChem CID | 8796994 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 11-(1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)undecanamide |
| SMILES | O=C(CCCCCCCCCCN1C(=O)c2ccccc2C1=O)NCc1ccco1 |
| InChI | InChI=1S/C24H30N2O4/c27-22(25-18-19-12-11-17-30-19)15-7-5-3-1-2-4-6-10-16-26-23(28)20-13-8-9-14-21(20)24(26)29/h8-9,11-14,17H,1-7,10,15-16,18H2,(H,25,27) |
| InChIKey | HRJGVJGOFVTMHX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|