C16H14N2O4S — CID 42603608
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(furan-2-ylmethyl)carbamothioate (PubChem CID 42603608) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(furan-2-ylmethyl)carbamothioate.
| Compound Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(furan-2-ylmethyl)carbamothioate |
|---|---|
| PubChem CID | 42603608 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(furan-2-ylmethyl)carbamothioate |
| SMILES | O=C1c2ccccc2C(=O)N1CCOC(=S)NCc1ccco1 |
| InChI | InChI=1S/C16H14N2O4S/c19-14-12-5-1-2-6-13(12)15(20)18(14)7-9-22-16(23)17-10-11-4-3-8-21-11/h1-6,8H,7,9-10H2,(H,17,23) |
| InChIKey | LSMAWTWJSSWDKX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|